C12H15Br2NO — CID 107741061
2,6-dibromo-4-[[[(E)-pent-3-enyl]amino]methyl]phenol (PubChem CID 107741061) has the molecular formula C12H15Br2NO and a molecular weight of 349.07 g/mol. Its IUPAC name is 2,6-dibromo-4-[[[(E)-pent-3-enyl]amino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[[(E)-pent-3-enyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 107741061 |
| Molecular Formula | C12H15Br2NO |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 2,6-dibromo-4-[[[(E)-pent-3-enyl]amino]methyl]phenol |
| SMILES | C/C=C/CCNCc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C12H15Br2NO/c1-2-3-4-5-15-8-9-6-10(13)12(16)11(14)7-9/h2-3,6-7,15-16H,4-5,8H2,1H3/b3-2+ |
| InChIKey | VOYYCCTYARHNPK-NSCUHMNNSA-N |
| XLogP | 3.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|