C11H15Br2NOS — CID 107740808
2,6-dibromo-4-[(3-methylsulfanylpropylamino)methyl]phenol (PubChem CID 107740808) has the molecular formula C11H15Br2NOS and a molecular weight of 369.12 g/mol. Its IUPAC name is 2,6-dibromo-4-[(3-methylsulfanylpropylamino)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(3-methylsulfanylpropylamino)methyl]phenol |
|---|---|
| PubChem CID | 107740808 |
| Molecular Formula | C11H15Br2NOS |
| Molecular Weight | 369.12 g/mol |
| Exact Mass | 366.92 |
| IUPAC Name | 2,6-dibromo-4-[(3-methylsulfanylpropylamino)methyl]phenol |
| SMILES | CSCCCNCc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C11H15Br2NOS/c1-16-4-2-3-14-7-8-5-9(12)11(15)10(13)6-8/h5-6,14-15H,2-4,7H2,1H3 |
| InChIKey | NINXSDDDAVWWMV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.12 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|