C9H13Br2NS2 — CID 102835841
N-[(4,5-dibromothiophen-2-yl)methyl]-3-methylsulfanylpropan-1-amine (PubChem CID 102835841) has the molecular formula C9H13Br2NS2 and a molecular weight of 359.15 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 102835841 |
| Molecular Formula | C9H13Br2NS2 |
| Molecular Weight | 359.15 g/mol |
| Exact Mass | 356.89 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-methylsulfanylpropan-1-amine |
| SMILES | CSCCCNCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H13Br2NS2/c1-13-4-2-3-12-6-7-5-8(10)9(11)14-7/h5,12H,2-4,6H2,1H3 |
| InChIKey | YNQFJZHSPJOEJD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|