C10H13Br2NS — CID 102836218
2-cyclopropyl-N-[(4,5-dibromothiophen-2-yl)methyl]ethanamine (PubChem CID 102836218) has the molecular formula C10H13Br2NS and a molecular weight of 339.10 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(4,5-dibromothiophen-2-yl)methyl]ethanamine.
| Compound Name | 2-cyclopropyl-N-[(4,5-dibromothiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 102836218 |
| Molecular Formula | C10H13Br2NS |
| Molecular Weight | 339.10 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | 2-cyclopropyl-N-[(4,5-dibromothiophen-2-yl)methyl]ethanamine |
| SMILES | Brc1cc(CNCCC2CC2)sc1Br |
| InChI | InChI=1S/C10H13Br2NS/c11-9-5-8(14-10(9)12)6-13-4-3-7-1-2-7/h5,7,13H,1-4,6H2 |
| InChIKey | QBXFTHDPLKFREK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.10 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|