C10H11Br2NOS — CID 79036871
4,5-dibromo-N-(2-cyclopropylethyl)thiophene-2-carboxamide (PubChem CID 79036871) has the molecular formula C10H11Br2NOS and a molecular weight of 353.08 g/mol. Its IUPAC name is 4,5-dibromo-N-(2-cyclopropylethyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(2-cyclopropylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79036871 |
| Molecular Formula | C10H11Br2NOS |
| Molecular Weight | 353.08 g/mol |
| Exact Mass | 350.89 |
| IUPAC Name | 4,5-dibromo-N-(2-cyclopropylethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCC1CC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H11Br2NOS/c11-7-5-8(15-9(7)12)10(14)13-4-3-6-1-2-6/h5-6H,1-4H2,(H,13,14) |
| InChIKey | YPDJPTJEYXXUCX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.08 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |