C14H20Br2N2OS — CID 115306468
4,5-dibromo-N-[2-(cycloheptylamino)ethyl]thiophene-2-carboxamide (PubChem CID 115306468) has the molecular formula C14H20Br2N2OS and a molecular weight of 424.20 g/mol. Its IUPAC name is 4,5-dibromo-N-[2-(cycloheptylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[2-(cycloheptylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115306468 |
| Molecular Formula | C14H20Br2N2OS |
| Molecular Weight | 424.20 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | 4,5-dibromo-N-[2-(cycloheptylamino)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCNC1CCCCCC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H20Br2N2OS/c15-11-9-12(20-13(11)16)14(19)18-8-7-17-10-5-3-1-2-4-6-10/h9-10,17H,1-8H2,(H,18,19) |
| InChIKey | ZHHJNWXOMATDPA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|