C17H21FN2OS — CID 19008852
N-[2-(cyclohexylamino)ethyl]-5-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 19008852) has the molecular formula C17H21FN2OS and a molecular weight of 320.43 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)ethyl]-5-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(cyclohexylamino)ethyl]-5-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 19008852 |
| Molecular Formula | C17H21FN2OS |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[2-(cyclohexylamino)ethyl]-5-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCNC1CCCCC1)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C17H21FN2OS/c18-13-6-7-15-12(10-13)11-16(22-15)17(21)20-9-8-19-14-4-2-1-3-5-14/h6-7,10-11,14,19H,1-5,8-9H2,(H,20,21) |
| InChIKey | WCVKIWSIFLHPPQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|