C22H33N3O2S — CID 139937755
N-[4-[2-(cyclohexylamino)ethylamino]butyl]-5-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 139937755) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is N-[4-[2-(cyclohexylamino)ethylamino]butyl]-5-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-[2-(cyclohexylamino)ethylamino]butyl]-5-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 139937755 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[4-[2-(cyclohexylamino)ethylamino]butyl]-5-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2sc(C(=O)NCCCCNCCNC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C22H33N3O2S/c1-27-19-9-10-20-17(15-19)16-21(28-20)22(26)25-12-6-5-11-23-13-14-24-18-7-3-2-4-8-18/h9-10,15-16,18,23-24H,2-8,11-14H2,1H3,(H,25,26) |
| InChIKey | GIBSCZSMEWEDSH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|