C32H58Cl2N6O2 — CID 512375
1-N,4-N-bis[4-[2-(cyclohexylamino)ethylamino]butyl]benzene-1,4-dicarboxamide;dihydrochloride (PubChem CID 512375) has the molecular formula C32H58Cl2N6O2 and a molecular weight of 629.76 g/mol. Its IUPAC name is 1-N,4-N-bis[4-[2-(cyclohexylamino)ethylamino]butyl]benzene-1,4-dicarboxamide;dihydrochloride.
| Compound Name | 1-N,4-N-bis[4-[2-(cyclohexylamino)ethylamino]butyl]benzene-1,4-dicarboxamide;dihydrochloride |
|---|---|
| PubChem CID | 512375 |
| Molecular Formula | C32H58Cl2N6O2 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | 1-N,4-N-bis[4-[2-(cyclohexylamino)ethylamino]butyl]benzene-1,4-dicarboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCCNCCNC1CCCCC1)c1ccc(C(=O)NCCCCNCCNC2CCCCC2)cc1 |
| InChI | InChI=1S/C32H56N6O2.2ClH/c39-31(37-21-9-7-19-33-23-25-35-29-11-3-1-4-12-29)27-15-17-28(18-16-27)32(40)38-22-10-8-20-34-24-26-36-30-13-5-2-6-14-30;;/h15-18,29-30,33-36H,1-14,19-26H2,(H,37,39)(H,38,40);2*1H |
| InChIKey | BJWIZZNPMQUFGC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|