C18H28ClN3O2 — CID 119621482
3-N-[2-(cycloheptylamino)ethyl]-1-N-methylbenzene-1,3-dicarboxamide;hydrochloride (PubChem CID 119621482) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 3-N-[2-(cycloheptylamino)ethyl]-1-N-methylbenzene-1,3-dicarboxamide;hydrochloride.
| Compound Name | 3-N-[2-(cycloheptylamino)ethyl]-1-N-methylbenzene-1,3-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119621482 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-N-[2-(cycloheptylamino)ethyl]-1-N-methylbenzene-1,3-dicarboxamide;hydrochloride |
| SMILES | CNC(=O)c1cccc(C(=O)NCCNC2CCCCCC2)c1.Cl |
| InChI | InChI=1S/C18H27N3O2.ClH/c1-19-17(22)14-7-6-8-15(13-14)18(23)21-12-11-20-16-9-4-2-3-5-10-16;/h6-8,13,16,20H,2-5,9-12H2,1H3,(H,19,22)(H,21,23);1H |
| InChIKey | GTEFBUBOOMIWAU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|