C19H27Cl2N3O — CID 119620989
N-[2-(cycloheptylamino)ethyl]quinoline-6-carboxamide;dihydrochloride (PubChem CID 119620989) has the molecular formula C19H27Cl2N3O and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]quinoline-6-carboxamide;dihydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]quinoline-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119620989 |
| Molecular Formula | C19H27Cl2N3O |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]quinoline-6-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCNC1CCCCCC1)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C19H25N3O.2ClH/c23-19(16-9-10-18-15(14-16)6-5-11-21-18)22-13-12-20-17-7-3-1-2-4-8-17;;/h5-6,9-11,14,17,20H,1-4,7-8,12-13H2,(H,22,23);2*1H |
| InChIKey | PJJQWYPZCDRYTM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|