C21H28ClN3O2S — CID 119621057
N-[3-[2-(cycloheptylamino)ethylcarbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119621057) has the molecular formula C21H28ClN3O2S and a molecular weight of 421.99 g/mol. Its IUPAC name is N-[3-[2-(cycloheptylamino)ethylcarbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[2-(cycloheptylamino)ethylcarbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119621057 |
| Molecular Formula | C21H28ClN3O2S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[3-[2-(cycloheptylamino)ethylcarbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCNC1CCCCCC1)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H27N3O2S.ClH/c25-20(23-13-12-22-17-8-3-1-2-4-9-17)16-7-5-10-18(15-16)24-21(26)19-11-6-14-27-19;/h5-7,10-11,14-15,17,22H,1-4,8-9,12-13H2,(H,23,25)(H,24,26);1H |
| InChIKey | PDPTVIXBGHTUDO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|