C21H24N2O2S — CID 8732814
N-[3-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]thiophene-2-carboxamide (PubChem CID 8732814) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[3-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 8732814 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[3-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CC[C@@H]3CCCC[C@@H]3C2)c1)c1cccs1 |
| InChI | InChI=1S/C21H24N2O2S/c24-20(19-9-4-12-26-19)22-18-8-3-7-16(13-18)21(25)23-11-10-15-5-1-2-6-17(15)14-23/h3-4,7-9,12-13,15,17H,1-2,5-6,10-11,14H2,(H,22,24)/t15-,17+/m0/s1 |
| InChIKey | IWSMLCKQNSTUJZ-DOTOQJQBSA-N |
| XLogP | 4.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |