C16H21NOS — CID 107023397
3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-sulfanylphenyl)methanone (PubChem CID 107023397) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-sulfanylphenyl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107023397 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl-(3-sulfanylphenyl)methanone |
| SMILES | O=C(c1cccc(S)c1)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H21NOS/c18-16(13-6-3-7-15(19)10-13)17-9-8-12-4-1-2-5-14(12)11-17/h3,6-7,10,12,14,19H,1-2,4-5,8-9,11H2 |
| InChIKey | YQKKAGVMKZCMDD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|