C14H19NOS — CID 107028906
(4,4-dimethylpiperidin-1-yl)-(3-sulfanylphenyl)methanone (PubChem CID 107028906) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is (4,4-dimethylpiperidin-1-yl)-(3-sulfanylphenyl)methanone.
| Compound Name | (4,4-dimethylpiperidin-1-yl)-(3-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107028906 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (4,4-dimethylpiperidin-1-yl)-(3-sulfanylphenyl)methanone |
| SMILES | CC1(C)CCN(C(=O)c2cccc(S)c2)CC1 |
| InChI | InChI=1S/C14H19NOS/c1-14(2)6-8-15(9-7-14)13(16)11-4-3-5-12(17)10-11/h3-5,10,17H,6-9H2,1-2H3 |
| InChIKey | YMQPMMZNFIJJBM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|