C15H23ClN2O — CID 119803719
(3-aminophenyl)-(4,4-dimethylazepan-1-yl)methanone;hydrochloride (PubChem CID 119803719) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is (3-aminophenyl)-(4,4-dimethylazepan-1-yl)methanone;hydrochloride.
| Compound Name | (3-aminophenyl)-(4,4-dimethylazepan-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119803719 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (3-aminophenyl)-(4,4-dimethylazepan-1-yl)methanone;hydrochloride |
| SMILES | CC1(C)CCCN(C(=O)c2cccc(N)c2)CC1.Cl |
| InChI | InChI=1S/C15H22N2O.ClH/c1-15(2)7-4-9-17(10-8-15)14(18)12-5-3-6-13(16)11-12;/h3,5-6,11H,4,7-10,16H2,1-2H3;1H |
| InChIKey | FENNNAJMCXIXAT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|