C20H24N2O — CID 25355501
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-pyrrol-1-ylphenyl)methanone (PubChem CID 25355501) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-pyrrol-1-ylphenyl)methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-pyrrol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 25355501 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-pyrrol-1-ylphenyl)methanone |
| SMILES | O=C(c1cccc(-n2cccc2)c1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C20H24N2O/c23-20(22-13-10-16-6-1-2-7-18(16)15-22)17-8-5-9-19(14-17)21-11-3-4-12-21/h3-5,8-9,11-12,14,16,18H,1-2,6-7,10,13,15H2/t16-,18-/m0/s1 |
| InChIKey | FJXDURMNLJSLDJ-WMZOPIPTSA-N |
| XLogP | 4.13 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |