C18H22N2O3 — CID 95973877
3-[3-[(3aS,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 95973877) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-[3-[(3aS,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-[(3aS,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 95973877 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[3-[(3aS,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(c1cccc(N2CCOC2=O)c1)N1C[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C18H22N2O3/c21-17(19-11-14-4-1-2-5-15(14)12-19)13-6-3-7-16(10-13)20-8-9-23-18(20)22/h3,6-7,10,14-15H,1-2,4-5,8-9,11-12H2/t14-,15-/m1/s1 |
| InChIKey | PSBFZMNLKGUIPD-HUUCEWRRSA-N |
| XLogP | 2.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |