C14H17NO — CID 15855718
[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-phenylmethanone (PubChem CID 15855718) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is [(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-phenylmethanone.
| Compound Name | [(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 15855718 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | [(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C14H17NO/c16-14(11-5-2-1-3-6-11)15-9-12-7-4-8-13(12)10-15/h1-3,5-6,12-13H,4,7-10H2/t12-,13+ |
| InChIKey | KJYHUJCPKAVRQX-BETUJISGSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |