C15H19NO2 — CID 125473675
[(4aR,8aR)-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-3-yl]-phenylmethanone (PubChem CID 125473675) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is [(4aR,8aR)-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-3-yl]-phenylmethanone.
| Compound Name | [(4aR,8aR)-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 125473675 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [(4aR,8aR)-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CO[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C15H19NO2/c17-15(12-6-2-1-3-7-12)16-10-13-8-4-5-9-14(13)18-11-16/h1-3,6-7,13-14H,4-5,8-11H2/t13-,14-/m1/s1 |
| InChIKey | UYEFDQJXIWLENZ-ZIAGYGMSSA-N |
| XLogP | 2.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |