C16H19NO3 — CID 10333493
(5aR,9aS)-4-benzoyl-5a,6,7,8,9,9a-hexahydro-5H-benzo[f][1,4]oxazepin-3-one (PubChem CID 10333493) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (5aR,9aS)-4-benzoyl-5a,6,7,8,9,9a-hexahydro-5H-benzo[f][1,4]oxazepin-3-one.
| Compound Name | (5aR,9aS)-4-benzoyl-5a,6,7,8,9,9a-hexahydro-5H-benzo[f][1,4]oxazepin-3-one |
|---|---|
| PubChem CID | 10333493 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (5aR,9aS)-4-benzoyl-5a,6,7,8,9,9a-hexahydro-5H-benzo[f][1,4]oxazepin-3-one |
| SMILES | O=C1CO[C@H]2CCCC[C@@H]2CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO3/c18-15-11-20-14-9-5-4-8-13(14)10-17(15)16(19)12-6-2-1-3-7-12/h1-3,6-7,13-14H,4-5,8-11H2/t13-,14+/m1/s1 |
| InChIKey | KJDYGFQXXMIDLC-KGLIPLIRSA-N |
| XLogP | 2.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|