C10H9NO3 — CID 70346533
3-benzoyl-1,3-oxazolidin-4-one (PubChem CID 70346533) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 3-benzoyl-1,3-oxazolidin-4-one.
| Compound Name | 3-benzoyl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 70346533 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 3-benzoyl-1,3-oxazolidin-4-one |
| SMILES | O=C1COCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H9NO3/c12-9-6-14-7-11(9)10(13)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | DZHUVHMTOFICBR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|