C11H9NO3S — CID 165356113
4-(benzenecarbonothioyl)morpholine-3,5-dione (PubChem CID 165356113) has the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. Its IUPAC name is 4-(benzenecarbonothioyl)morpholine-3,5-dione.
| Compound Name | 4-(benzenecarbonothioyl)morpholine-3,5-dione |
|---|---|
| PubChem CID | 165356113 |
| Molecular Formula | C11H9NO3S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 4-(benzenecarbonothioyl)morpholine-3,5-dione |
| SMILES | O=C1COCC(=O)N1C(=S)c1ccccc1 |
| InChI | InChI=1S/C11H9NO3S/c13-9-6-15-7-10(14)12(9)11(16)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | IAKXBRVJKPIDIW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|