C13H11NO5 — CID 71476745
methyl (Z)-3-(2,4-dioxo-1,3-oxazolidin-3-yl)-3-phenylprop-2-enoate (PubChem CID 71476745) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is methyl (Z)-3-(2,4-dioxo-1,3-oxazolidin-3-yl)-3-phenylprop-2-enoate.
| Compound Name | methyl (Z)-3-(2,4-dioxo-1,3-oxazolidin-3-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 71476745 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | methyl (Z)-3-(2,4-dioxo-1,3-oxazolidin-3-yl)-3-phenylprop-2-enoate |
| SMILES | COC(=O)/C=C(/c1ccccc1)N1C(=O)COC1=O |
| InChI | InChI=1S/C13H11NO5/c1-18-12(16)7-10(9-5-3-2-4-6-9)14-11(15)8-19-13(14)17/h2-7H,8H2,1H3/b10-7- |
| InChIKey | WJLXEJOKLKFHBC-YFHOEESVSA-N |
| XLogP | 1.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|