C24H20O2 — CID 101482031
methyl (2E,4E)-3,4,5-triphenylpenta-2,4-dienoate (PubChem CID 101482031) has the molecular formula C24H20O2 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl (2E,4E)-3,4,5-triphenylpenta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-3,4,5-triphenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 101482031 |
| Molecular Formula | C24H20O2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl (2E,4E)-3,4,5-triphenylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(C(=C/c1ccccc1)/c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C24H20O2/c1-26-24(25)18-23(21-15-9-4-10-16-21)22(20-13-7-3-8-14-20)17-19-11-5-2-6-12-19/h2-18H,1H3/b22-17+,23-18+ |
| InChIKey | HJTNEBWPXJJWRT-SKWBHROBSA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|