(Z)-2,3-diphenylprop-2-enoyl chloride

C15H11ClO — CID 12558834

IUPAC(Z)-2,3-diphenylprop-2-enoyl chloride
SMILESO=C(Cl)/C(=C\c1ccccc1)c1ccccc1
InChIInChI=1S/C15H11ClO/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H/b14-11-
InChIKeyUJZRIKWTEFFUEJ-KAMYIIQDSA-N
MW242.71 g/mol
LogP3.99
Rot. Bonds3

About (Z)-2,3-diphenylprop-2-enoyl chloride

(Z)-2,3-diphenylprop-2-enoyl chloride (PubChem CID 12558834) has the molecular formula C15H11ClO and a molecular weight of 242.71 g/mol. Its IUPAC name is (Z)-2,3-diphenylprop-2-enoyl chloride.

Molecular Properties

Compound Name(Z)-2,3-diphenylprop-2-enoyl chloride
PubChem CID12558834
Molecular FormulaC15H11ClO
Molecular Weight242.71 g/mol
Exact Mass242.05
IUPAC Name(Z)-2,3-diphenylprop-2-enoyl chloride
SMILESO=C(Cl)/C(=C\c1ccccc1)c1ccccc1
InChIInChI=1S/C15H11ClO/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H/b14-11-
InChIKeyUJZRIKWTEFFUEJ-KAMYIIQDSA-N
XLogP3.99
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.71
LogP ≤ 53.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze (Z)-2,3-diphenylprop-2-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2,3-diphenylprop-2-enoyl chloride?
The IUPAC name of (Z)-2,3-diphenylprop-2-enoyl chloride (CID 12558834) is (Z)-2,3-diphenylprop-2-enoyl chloride.
What is the SMILES notation for (Z)-2,3-diphenylprop-2-enoyl chloride?
The canonical SMILES for (Z)-2,3-diphenylprop-2-enoyl chloride is O=C(Cl)/C(=C\c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-2,3-diphenylprop-2-enoyl chloride?
The InChIKey is UJZRIKWTEFFUEJ-KAMYIIQDSA-N. The full InChI is InChI=1S/C15H11ClO/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H/b14-11-.
What are the key properties of (Z)-2,3-diphenylprop-2-enoyl chloride?
(Z)-2,3-diphenylprop-2-enoyl chloride has a molecular weight of 242.71 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-diphenylprop-2-enoyl chloride is sourced from PubChem (CID 12558834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).