C29H20Br2O — CID 156774836
2,4-bis(3-bromophenyl)-1,5-diphenylpenta-1,4-dien-3-one (PubChem CID 156774836) has the molecular formula C29H20Br2O and a molecular weight of 544.29 g/mol. Its IUPAC name is 2,4-bis(3-bromophenyl)-1,5-diphenylpenta-1,4-dien-3-one.
| Compound Name | 2,4-bis(3-bromophenyl)-1,5-diphenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 156774836 |
| Molecular Formula | C29H20Br2O |
| Molecular Weight | 544.29 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | 2,4-bis(3-bromophenyl)-1,5-diphenylpenta-1,4-dien-3-one |
| SMILES | O=C(C(=Cc1ccccc1)c1cccc(Br)c1)C(=Cc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C29H20Br2O/c30-25-15-7-13-23(19-25)27(17-21-9-3-1-4-10-21)29(32)28(18-22-11-5-2-6-12-22)24-14-8-16-26(31)20-24/h1-20H |
| InChIKey | SYJBSXBIVCPPPJ-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.29 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|