C23H25BrO2 — CID 67693762
2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoic acid (PubChem CID 67693762) has the molecular formula C23H25BrO2 and a molecular weight of 413.36 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoic acid.
| Compound Name | 2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67693762 |
| Molecular Formula | C23H25BrO2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(C=C(C(=O)O)c3cccc(Br)c3)ccc21 |
| InChI | InChI=1S/C23H25BrO2/c1-22(2)10-11-23(3,4)20-13-15(8-9-19(20)22)12-18(21(25)26)16-6-5-7-17(24)14-16/h5-9,12-14H,10-11H2,1-4H3,(H,25,26) |
| InChIKey | OCQYYORYUTXDNW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|