C26H31BrO — CID 54451259
2-(3-bromophenyl)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)hexa-2,4-dien-1-ol (PubChem CID 54451259) has the molecular formula C26H31BrO and a molecular weight of 439.44 g/mol. Its IUPAC name is 2-(3-bromophenyl)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)hexa-2,4-dien-1-ol.
| Compound Name | 2-(3-bromophenyl)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)hexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 54451259 |
| Molecular Formula | C26H31BrO |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-(3-bromophenyl)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)hexa-2,4-dien-1-ol |
| SMILES | CC(=CC=C(CO)c1cccc(Br)c1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H31BrO/c1-18(9-10-21(17-28)20-7-6-8-22(27)15-20)19-11-12-23-24(16-19)26(4,5)14-13-25(23,2)3/h6-12,15-16,28H,13-14,17H2,1-5H3 |
| InChIKey | WVDGAAFVPHPZGT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|