C18H28BrP — CID 173337353
3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enylphosphane;hydrobromide (PubChem CID 173337353) has the molecular formula C18H28BrP and a molecular weight of 355.30 g/mol. Its IUPAC name is 3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enylphosphane;hydrobromide.
| Compound Name | 3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enylphosphane;hydrobromide |
|---|---|
| PubChem CID | 173337353 |
| Molecular Formula | C18H28BrP |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enylphosphane;hydrobromide |
| SMILES | Br.CC(=CCP)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C18H27P.BrH/c1-13(8-11-19)14-6-7-15-16(12-14)18(4,5)10-9-17(15,2)3;/h6-8,12H,9-11,19H2,1-5H3;1H |
| InChIKey | PHAJWJOYLSMAQO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|