C26H38 — CID 143916789
6-[(2E)-5-cyclohexylhexa-2,5-dien-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 143916789) has the molecular formula C26H38 and a molecular weight of 350.59 g/mol. Its IUPAC name is 6-[(2E)-5-cyclohexylhexa-2,5-dien-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-[(2E)-5-cyclohexylhexa-2,5-dien-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 143916789 |
| Molecular Formula | C26H38 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | 6-[(2E)-5-cyclohexylhexa-2,5-dien-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | C=C(C/C=C(\C)c1ccc2c(c1)C(C)(C)CCC2(C)C)C1CCCCC1 |
| InChI | InChI=1S/C26H38/c1-19(21-10-8-7-9-11-21)12-13-20(2)22-14-15-23-24(18-22)26(5,6)17-16-25(23,3)4/h13-15,18,21H,1,7-12,16-17H2,2-6H3/b20-13+ |
| InChIKey | LXBJZQUMADIYHE-DEDYPNTBSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|