C25H32 — CID 14425598
6-[(E)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 14425598) has the molecular formula C25H32 and a molecular weight of 332.53 g/mol. Its IUPAC name is 6-[(E)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-[(E)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 14425598 |
| Molecular Formula | C25H32 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 6-[(E)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | C/C(=C\c1cc(C)cc(C)c1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H32/c1-17-12-18(2)14-20(13-17)15-19(3)21-8-9-22-23(16-21)25(6,7)11-10-24(22,4)5/h8-9,12-16H,10-11H2,1-7H3/b19-15+ |
| InChIKey | PDLSJCOSPAAFNC-XDJHFCHBSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|