C25H32O3 — CID 70410841
2,3-dimethoxy-5-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenol (PubChem CID 70410841) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenol.
| Compound Name | 2,3-dimethoxy-5-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenol |
|---|---|
| PubChem CID | 70410841 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 2,3-dimethoxy-5-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenol |
| SMILES | COc1cc(/C=C(\C)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc(O)c1OC |
| InChI | InChI=1S/C25H32O3/c1-16(12-17-13-21(26)23(28-7)22(14-17)27-6)18-8-9-19-20(15-18)25(4,5)11-10-24(19,2)3/h8-9,12-15,26H,10-11H2,1-7H3/b16-12+ |
| InChIKey | DNHIHCLZJITVJQ-FOWTUZBSSA-N |
| XLogP | 6.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|