C24H26O3 — CID 70411697
5-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]-1,3-benzodioxol-2-one (PubChem CID 70411697) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 5-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]-1,3-benzodioxol-2-one.
| Compound Name | 5-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]-1,3-benzodioxol-2-one |
|---|---|
| PubChem CID | 70411697 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 5-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]-1,3-benzodioxol-2-one |
| SMILES | C/C(=C\c1ccc2oc(=O)oc2c1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H26O3/c1-15(12-16-6-9-20-21(13-16)27-22(25)26-20)17-7-8-18-19(14-17)24(4,5)11-10-23(18,2)3/h6-9,12-14H,10-11H2,1-5H3/b15-12+ |
| InChIKey | NDCJMJYSPFTXPV-NTCAYCPXSA-N |
| XLogP | 6.30 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|