C25H32O3S — CID 54045323
2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]sulfonylethanol (PubChem CID 54045323) has the molecular formula C25H32O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is 2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]sulfonylethanol.
| Compound Name | 2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]sulfonylethanol |
|---|---|
| PubChem CID | 54045323 |
| Molecular Formula | C25H32O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]sulfonylethanol |
| SMILES | CC(=Cc1ccc(S(=O)(=O)CCO)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H32O3S/c1-18(16-19-6-9-21(10-7-19)29(27,28)15-14-26)20-8-11-22-23(17-20)25(4,5)13-12-24(22,2)3/h6-11,16-17,26H,12-15H2,1-5H3 |
| InChIKey | LPDOOXGMTFEVJL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|