C26H35NO — CID 54313138
N-methyl-2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethanamine (PubChem CID 54313138) has the molecular formula C26H35NO and a molecular weight of 377.57 g/mol. Its IUPAC name is N-methyl-2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethanamine.
| Compound Name | N-methyl-2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 54313138 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | N-methyl-2-[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethanamine |
| SMILES | CNCCOc1ccc(C=C(C)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C26H35NO/c1-19(17-20-7-10-22(11-8-20)28-16-15-27-6)21-9-12-23-24(18-21)26(4,5)14-13-25(23,2)3/h7-12,17-18,27H,13-16H2,1-6H3 |
| InChIKey | SMHJTRQIXRVBIK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|