C29H37NO3S — CID 18658225
4-[2-[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-thiazine 1,1-dioxide (PubChem CID 18658225) has the molecular formula C29H37NO3S and a molecular weight of 479.69 g/mol. Its IUPAC name is 4-[2-[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-thiazine 1,1-dioxide.
| Compound Name | 4-[2-[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-thiazine 1,1-dioxide |
|---|---|
| PubChem CID | 18658225 |
| Molecular Formula | C29H37NO3S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 4-[2-[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-thiazine 1,1-dioxide |
| SMILES | C/C(=C\c1ccc(OCCN2C=CS(=O)(=O)CC2)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H37NO3S/c1-22(24-8-11-26-27(21-24)29(4,5)13-12-28(26,2)3)20-23-6-9-25(10-7-23)33-17-14-30-15-18-34(31,32)19-16-30/h6-11,15,18,20-21H,12-14,16-17,19H2,1-5H3/b22-20+ |
| InChIKey | WBOKVMSKXXNVTG-LSDHQDQOSA-N |
| XLogP | 6.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|