C31H45O3P — CID 54268943
6-[1-(4-dibutoxyphosphorylphenyl)prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 54268943) has the molecular formula C31H45O3P and a molecular weight of 496.67 g/mol. Its IUPAC name is 6-[1-(4-dibutoxyphosphorylphenyl)prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-[1-(4-dibutoxyphosphorylphenyl)prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 54268943 |
| Molecular Formula | C31H45O3P |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 6-[1-(4-dibutoxyphosphorylphenyl)prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | CCCCOP(=O)(OCCCC)c1ccc(C=C(C)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C31H45O3P/c1-8-10-20-33-35(32,34-21-11-9-2)27-15-12-25(13-16-27)22-24(3)26-14-17-28-29(23-26)31(6,7)19-18-30(28,4)5/h12-17,22-23H,8-11,18-21H2,1-7H3 |
| InChIKey | RIUCFRBVBGJTKH-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|