C27H37O2P — CID 139786055
6-[(E)-1-[4-[ethoxy(ethyl)phosphoryl]phenyl]prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 139786055) has the molecular formula C27H37O2P and a molecular weight of 424.57 g/mol. Its IUPAC name is 6-[(E)-1-[4-[ethoxy(ethyl)phosphoryl]phenyl]prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-[(E)-1-[4-[ethoxy(ethyl)phosphoryl]phenyl]prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 139786055 |
| Molecular Formula | C27H37O2P |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 6-[(E)-1-[4-[ethoxy(ethyl)phosphoryl]phenyl]prop-1-en-2-yl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | CCOP(=O)(CC)c1ccc(/C=C(\C)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C27H37O2P/c1-8-29-30(28,9-2)23-13-10-21(11-14-23)18-20(3)22-12-15-24-25(19-22)27(6,7)17-16-26(24,4)5/h10-15,18-19H,8-9,16-17H2,1-7H3/b20-18+ |
| InChIKey | LWHIMTXBNCVEFU-CZIZESTLSA-N |
| XLogP | 7.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|