C26H37N2O2P — CID 70425098
N-[methylamino-[[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methoxy]phosphoryl]methanamine (PubChem CID 70425098) has the molecular formula C26H37N2O2P and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[methylamino-[[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methoxy]phosphoryl]methanamine.
| Compound Name | N-[methylamino-[[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methoxy]phosphoryl]methanamine |
|---|---|
| PubChem CID | 70425098 |
| Molecular Formula | C26H37N2O2P |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | N-[methylamino-[[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methoxy]phosphoryl]methanamine |
| SMILES | CNP(=O)(NC)OCc1ccc(/C=C(\C)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C26H37N2O2P/c1-19(16-20-8-10-21(11-9-20)18-30-31(29,27-6)28-7)22-12-13-23-24(17-22)26(4,5)15-14-25(23,2)3/h8-13,16-17H,14-15,18H2,1-7H3,(H2,27,28,29)/b19-16+ |
| InChIKey | WRYGSLWHPROJLL-KNTRCKAVSA-N |
| XLogP | 6.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|