C28H45N2O4P — CID 70425594
bis(N-methylmethanamine);[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methyl dihydrogen phosphate (PubChem CID 70425594) has the molecular formula C28H45N2O4P and a molecular weight of 504.65 g/mol. Its IUPAC name is bis(N-methylmethanamine);[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methyl dihydrogen phosphate.
| Compound Name | bis(N-methylmethanamine);[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 70425594 |
| Molecular Formula | C28H45N2O4P |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | bis(N-methylmethanamine);[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl]methyl dihydrogen phosphate |
| SMILES | CC(=Cc1ccc(COP(=O)(O)O)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C.CNC.CNC |
| InChI | InChI=1S/C24H31O4P.2C2H7N/c1-17(14-18-6-8-19(9-7-18)16-28-29(25,26)27)20-10-11-21-22(15-20)24(4,5)13-12-23(21,2)3;2*1-3-2/h6-11,14-15H,12-13,16H2,1-5H3,(H2,25,26,27);2*3H,1-2H3 |
| InChIKey | LBEGAXFMGKFOLS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|