C26H32O3 — CID 70411359
[2-methoxy-4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl] acetate (PubChem CID 70411359) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 70411359 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | [2-methoxy-4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenyl] acetate |
| SMILES | COc1cc(/C=C(\C)c2ccc3c(c2)C(C)(C)CCC3(C)C)ccc1OC(C)=O |
| InChI | InChI=1S/C26H32O3/c1-17(14-19-8-11-23(29-18(2)27)24(15-19)28-7)20-9-10-21-22(16-20)26(5,6)13-12-25(21,3)4/h8-11,14-16H,12-13H2,1-7H3/b17-14+ |
| InChIKey | CIDYJLZQGYOTAA-SAPNQHFASA-N |
| XLogP | 6.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|