C23H27Cl — CID 54469191
6-[2-(4-chlorophenyl)prop-1-enyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 54469191) has the molecular formula C23H27Cl and a molecular weight of 338.92 g/mol. Its IUPAC name is 6-[2-(4-chlorophenyl)prop-1-enyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-[2-(4-chlorophenyl)prop-1-enyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 54469191 |
| Molecular Formula | C23H27Cl |
| Molecular Weight | 338.92 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 6-[2-(4-chlorophenyl)prop-1-enyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | CC(=Cc1ccc2c(c1)C(C)(C)CCC2(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H27Cl/c1-16(18-7-9-19(24)10-8-18)14-17-6-11-20-21(15-17)23(4,5)13-12-22(20,2)3/h6-11,14-15H,12-13H2,1-5H3 |
| InChIKey | XHCDWRPNRUHZCA-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.92 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|