C26H32 — CID 54446394
1,1,4,4-tetramethyl-6-[2-(4-prop-2-enylphenyl)prop-1-enyl]-2,3-dihydronaphthalene (PubChem CID 54446394) has the molecular formula C26H32 and a molecular weight of 344.54 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-6-[2-(4-prop-2-enylphenyl)prop-1-enyl]-2,3-dihydronaphthalene.
| Compound Name | 1,1,4,4-tetramethyl-6-[2-(4-prop-2-enylphenyl)prop-1-enyl]-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 54446394 |
| Molecular Formula | C26H32 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 1,1,4,4-tetramethyl-6-[2-(4-prop-2-enylphenyl)prop-1-enyl]-2,3-dihydronaphthalene |
| SMILES | C=CCc1ccc(C(C)=Cc2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C26H32/c1-7-8-20-9-12-22(13-10-20)19(2)17-21-11-14-23-24(18-21)26(5,6)16-15-25(23,3)4/h7,9-14,17-18H,1,8,15-16H2,2-6H3 |
| InChIKey | WRVBFYBATSVRKM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|