About Pyrene
Pyrene (PubChem CID 31423) has the molecular formula C16H10
and a molecular weight of 202.25 g/mol. Its IUPAC name is pyrene.
Molecular Properties
| Compound Name | Pyrene |
| PubChem CID | 31423 |
| Molecular Formula | C16H10 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | pyrene |
| SMILES | C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
| InChI | InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H |
| InChIKey | BBEAQIROQSPTKN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | 217 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze Pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pyrene?
The IUPAC name of Pyrene (CID 31423) is pyrene.
What is the SMILES notation for Pyrene?
The canonical SMILES for Pyrene is C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2.
What is the InChIKey of Pyrene?
The InChIKey is BBEAQIROQSPTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H.
What are the key properties of Pyrene?
Pyrene has a molecular weight of 202.25 g/mol, XLogP of 4.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Pyrene is sourced from PubChem (CID 31423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).