About benzo[a]pyrene
benzo[a]pyrene (PubChem CID 2336) has the molecular formula C20H12
and a molecular weight of 252.32 g/mol. Its IUPAC name is benzo[a]pyrene.
Molecular Properties
| Compound Name | benzo[a]pyrene |
| PubChem CID | 2336 |
| Molecular Formula | C20H12 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | benzo[a]pyrene |
| SMILES | c1ccc2c(c1)cc1ccc3cccc4ccc2c1c34 |
| InChI | InChI=1S/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H |
| InChIKey | FMMWHPNWAFZXNH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[a]pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[a]pyrene?
The IUPAC name of benzo[a]pyrene (CID 2336) is benzo[a]pyrene.
What is the SMILES notation for benzo[a]pyrene?
The canonical SMILES for benzo[a]pyrene is c1ccc2c(c1)cc1ccc3cccc4ccc2c1c34.
What is the InChIKey of benzo[a]pyrene?
The InChIKey is FMMWHPNWAFZXNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H.
What are the key properties of benzo[a]pyrene?
benzo[a]pyrene has a molecular weight of 252.32 g/mol, XLogP of 5.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[a]pyrene is sourced from PubChem (CID 2336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).