About chrysene
chrysene (PubChem CID 9171) has the molecular formula C18H12
and a molecular weight of 228.29 g/mol. Its IUPAC name is chrysene.
Molecular Properties
| Compound Name | chrysene |
| PubChem CID | 9171 |
| Molecular Formula | C18H12 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | chrysene |
| SMILES | c1ccc2c(c1)ccc1c3ccccc3ccc21 |
| InChI | InChI=1S/C18H12/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1-12H |
| InChIKey | WDECIBYCCFPHNR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze chrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chrysene?
The IUPAC name of chrysene (CID 9171) is chrysene.
What is the SMILES notation for chrysene?
The canonical SMILES for chrysene is c1ccc2c(c1)ccc1c3ccccc3ccc21.
What is the InChIKey of chrysene?
The InChIKey is WDECIBYCCFPHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1-12H.
What are the key properties of chrysene?
chrysene has a molecular weight of 228.29 g/mol, XLogP of 5.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chrysene is sourced from PubChem (CID 9171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).