About anthracene
anthracene (PubChem CID 8418) has the molecular formula C14H10
and a molecular weight of 178.23 g/mol. Its IUPAC name is anthracene.
Molecular Properties
| Compound Name | anthracene |
| PubChem CID | 8418 |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | anthracene |
| SMILES | c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H |
| InChIKey | MWPLVEDNUUSJAV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene?
The IUPAC name of anthracene (CID 8418) is anthracene.
What is the SMILES notation for anthracene?
The canonical SMILES for anthracene is c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene?
The InChIKey is MWPLVEDNUUSJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H.
What are the key properties of anthracene?
anthracene has a molecular weight of 178.23 g/mol, XLogP of 3.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene is sourced from PubChem (CID 8418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).