About acenaphthylene
acenaphthylene (PubChem CID 9161) has the molecular formula C12H8
and a molecular weight of 152.20 g/mol. Its IUPAC name is acenaphthylene.
Molecular Properties
| Compound Name | acenaphthylene |
| PubChem CID | 9161 |
| Molecular Formula | C12H8 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | acenaphthylene |
| SMILES | C1=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H |
| InChIKey | HXGDTGSAIMULJN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze acenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acenaphthylene?
The IUPAC name of acenaphthylene (CID 9161) is acenaphthylene.
What is the SMILES notation for acenaphthylene?
The canonical SMILES for acenaphthylene is C1=Cc2cccc3cccc1c23.
What is the InChIKey of acenaphthylene?
The InChIKey is HXGDTGSAIMULJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-8H.
What are the key properties of acenaphthylene?
acenaphthylene has a molecular weight of 152.20 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acenaphthylene is sourced from PubChem (CID 9161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).