About 1,1'-biphenyl
1,1'-biphenyl (PubChem CID 7095) has the molecular formula C12H10
and a molecular weight of 154.21 g/mol. Its IUPAC name is 1,1'-biphenyl.
Molecular Properties
| Compound Name | 1,1'-biphenyl |
| PubChem CID | 7095 |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 1,1'-biphenyl |
| SMILES | c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
| InChIKey | ZUOUZKKEUPVFJK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1'-biphenyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl?
The IUPAC name of 1,1'-biphenyl (CID 7095) is 1,1'-biphenyl.
What is the SMILES notation for 1,1'-biphenyl?
The canonical SMILES for 1,1'-biphenyl is c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl?
The InChIKey is ZUOUZKKEUPVFJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 1,1'-biphenyl?
1,1'-biphenyl has a molecular weight of 154.21 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl is sourced from PubChem (CID 7095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).